About N-acetylacetamide;ethane
N-acetylacetamide;ethane (PubChem CID 142136912) has the molecular formula C6H13NO2
and a molecular weight of 131.17 g/mol. Its IUPAC name is N-acetylacetamide;ethane.
Molecular Properties
| Compound Name | N-acetylacetamide;ethane |
| PubChem CID | 142136912 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.17 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | N-acetylacetamide;ethane |
| SMILES | CC.CC(=O)NC(C)=O |
| InChI | InChI=1S/C4H7NO2.C2H6/c1-3(6)5-4(2)7;1-2/h1-2H3,(H,5,6,7);1-2H3 |
| InChIKey | VHLKWMAKSJOVHF-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.17 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-acetylacetamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-acetylacetamide;ethane?
The IUPAC name of N-acetylacetamide;ethane (CID 142136912) is N-acetylacetamide;ethane.
What is the SMILES notation for N-acetylacetamide;ethane?
The canonical SMILES for N-acetylacetamide;ethane is CC.CC(=O)NC(C)=O.
What is the InChIKey of N-acetylacetamide;ethane?
The InChIKey is VHLKWMAKSJOVHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO2.C2H6/c1-3(6)5-4(2)7;1-2/h1-2H3,(H,5,6,7);1-2H3.
What are the key properties of N-acetylacetamide;ethane?
N-acetylacetamide;ethane has a molecular weight of 131.17 g/mol, XLogP of 0.70, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-acetylacetamide;ethane is sourced from PubChem (CID 142136912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).