C20H25N3O — CID 142137195
4-(4-aminophenoxy)-N-(1-cyclobutylethenyl)pyridin-2-amine;cyclopropane (PubChem CID 142137195) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 4-(4-aminophenoxy)-N-(1-cyclobutylethenyl)pyridin-2-amine;cyclopropane.
| Compound Name | 4-(4-aminophenoxy)-N-(1-cyclobutylethenyl)pyridin-2-amine;cyclopropane |
|---|---|
| PubChem CID | 142137195 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 4-(4-aminophenoxy)-N-(1-cyclobutylethenyl)pyridin-2-amine;cyclopropane |
| SMILES | C1CC1.C=C(Nc1cc(Oc2ccc(N)cc2)ccn1)C1CCC1 |
| InChI | InChI=1S/C17H19N3O.C3H6/c1-12(13-3-2-4-13)20-17-11-16(9-10-19-17)21-15-7-5-14(18)6-8-15;1-2-3-1/h5-11,13H,1-4,18H2,(H,19,20);1-3H2 |
| InChIKey | YPRXAMUGMINXRM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|