About 3-(4-amino-3-hydroxybutanoyl)-5,6-dihydro-1,3-benzoxazol-2-one
3-(4-amino-3-hydroxybutanoyl)-5,6-dihydro-1,3-benzoxazol-2-one (PubChem CID 142137603) has the molecular formula C11H14N2O4
and a molecular weight of 238.24 g/mol. Its IUPAC name is 3-(4-amino-3-hydroxybutanoyl)-5,6-dihydro-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 3-(4-amino-3-hydroxybutanoyl)-5,6-dihydro-1,3-benzoxazol-2-one |
| PubChem CID | 142137603 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 3-(4-amino-3-hydroxybutanoyl)-5,6-dihydro-1,3-benzoxazol-2-one |
| SMILES | NCC(O)CC(=O)n1c(=O)oc2c1=CCCC=2 |
| InChI | InChI=1S/C11H14N2O4/c12-6-7(14)5-10(15)13-8-3-1-2-4-9(8)17-11(13)16/h3-4,7,14H,1-2,5-6,12H2 |
| InChIKey | ZZIPGNZYIMZBLR-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(4-amino-3-hydroxybutanoyl)-5,6-dihydro-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-amino-3-hydroxybutanoyl)-5,6-dihydro-1,3-benzoxazol-2-one?
The IUPAC name of 3-(4-amino-3-hydroxybutanoyl)-5,6-dihydro-1,3-benzoxazol-2-one (CID 142137603) is 3-(4-amino-3-hydroxybutanoyl)-5,6-dihydro-1,3-benzoxazol-2-one.
What is the SMILES notation for 3-(4-amino-3-hydroxybutanoyl)-5,6-dihydro-1,3-benzoxazol-2-one?
The canonical SMILES for 3-(4-amino-3-hydroxybutanoyl)-5,6-dihydro-1,3-benzoxazol-2-one is NCC(O)CC(=O)n1c(=O)oc2c1=CCCC=2.
What is the InChIKey of 3-(4-amino-3-hydroxybutanoyl)-5,6-dihydro-1,3-benzoxazol-2-one?
The InChIKey is ZZIPGNZYIMZBLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O4/c12-6-7(14)5-10(15)13-8-3-1-2-4-9(8)17-11(13)16/h3-4,7,14H,1-2,5-6,12H2.
What are the key properties of 3-(4-amino-3-hydroxybutanoyl)-5,6-dihydro-1,3-benzoxazol-2-one?
3-(4-amino-3-hydroxybutanoyl)-5,6-dihydro-1,3-benzoxazol-2-one has a molecular weight of 238.24 g/mol, XLogP of -1.85, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-amino-3-hydroxybutanoyl)-5,6-dihydro-1,3-benzoxazol-2-one is sourced from PubChem (CID 142137603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).