C11H22FNO3S — CID 142137613
N-[2-[(2R,3R)-5-fluoro-1,3-dihydroxy-2-methylpentyl]sulfanylethyl]propanamide (PubChem CID 142137613) has the molecular formula C11H22FNO3S and a molecular weight of 267.37 g/mol. Its IUPAC name is N-[2-[(2R,3R)-5-fluoro-1,3-dihydroxy-2-methylpentyl]sulfanylethyl]propanamide.
| Compound Name | N-[2-[(2R,3R)-5-fluoro-1,3-dihydroxy-2-methylpentyl]sulfanylethyl]propanamide |
|---|---|
| PubChem CID | 142137613 |
| Molecular Formula | C11H22FNO3S |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | N-[2-[(2R,3R)-5-fluoro-1,3-dihydroxy-2-methylpentyl]sulfanylethyl]propanamide |
| SMILES | CCC(=O)NCCSC(O)[C@H](C)[C@H](O)CCF |
| InChI | InChI=1S/C11H22FNO3S/c1-3-10(15)13-6-7-17-11(16)8(2)9(14)4-5-12/h8-9,11,14,16H,3-7H2,1-2H3,(H,13,15)/t8-,9-,11?/m1/s1 |
| InChIKey | TYNPEQQUCIWKSR-RUZZIDMASA-N |
| XLogP | 0.92 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|