About molecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole
molecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole (PubChem CID 142137650) has the molecular formula C7H10N4
and a molecular weight of 150.19 g/mol. Its IUPAC name is molecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole.
Molecular Properties
| Compound Name | molecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole |
| PubChem CID | 142137650 |
| Molecular Formula | C7H10N4 |
| Molecular Weight | 150.19 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | molecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole |
| SMILES | [H][H].c1ccc(C2=NNNN2)cc1 |
| InChI | InChI=1S/C7H8N4.H2/c1-2-4-6(5-3-1)7-8-10-11-9-7;/h1-5,10-11H,(H,8,9);1H |
| InChIKey | SUEWMVIXEFAOHT-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.19 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze molecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole?
The IUPAC name of molecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole (CID 142137650) is molecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole.
What is the SMILES notation for molecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole?
The canonical SMILES for molecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole is [H][H].c1ccc(C2=NNNN2)cc1.
What is the InChIKey of molecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole?
The InChIKey is SUEWMVIXEFAOHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4.H2/c1-2-4-6(5-3-1)7-8-10-11-9-7;/h1-5,10-11H,(H,8,9);1H.
What are the key properties of molecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole?
molecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole has a molecular weight of 150.19 g/mol, XLogP of 0.21, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole is sourced from PubChem (CID 142137650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).