molecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole

C7H10N4 — CID 142137650

IUPACmolecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole
SMILES[H][H].c1ccc(C2=NNNN2)cc1
InChIInChI=1S/C7H8N4.H2/c1-2-4-6(5-3-1)7-8-10-11-9-7;/h1-5,10-11H,(H,8,9);1H
InChIKeySUEWMVIXEFAOHT-UHFFFAOYSA-N
MW150.19 g/mol
LogP0.21
Rot. Bonds1

About molecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole

molecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole (PubChem CID 142137650) has the molecular formula C7H10N4 and a molecular weight of 150.19 g/mol. Its IUPAC name is molecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole.

Molecular Properties

Compound Namemolecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole
PubChem CID142137650
Molecular FormulaC7H10N4
Molecular Weight150.19 g/mol
Exact Mass150.09
IUPAC Namemolecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole
SMILES[H][H].c1ccc(C2=NNNN2)cc1
InChIInChI=1S/C7H8N4.H2/c1-2-4-6(5-3-1)7-8-10-11-9-7;/h1-5,10-11H,(H,8,9);1H
InChIKeySUEWMVIXEFAOHT-UHFFFAOYSA-N
XLogP0.21
TPSA48.45 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500150.19
LogP ≤ 50.21
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze molecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole?
The IUPAC name of molecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole (CID 142137650) is molecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole.
What is the SMILES notation for molecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole?
The canonical SMILES for molecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole is [H][H].c1ccc(C2=NNNN2)cc1.
What is the InChIKey of molecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole?
The InChIKey is SUEWMVIXEFAOHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4.H2/c1-2-4-6(5-3-1)7-8-10-11-9-7;/h1-5,10-11H,(H,8,9);1H.
What are the key properties of molecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole?
molecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole has a molecular weight of 150.19 g/mol, XLogP of 0.21, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;5-phenyl-2,3-dihydro-1H-tetrazole is sourced from PubChem (CID 142137650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).