About ethane;1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine
ethane;1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine (PubChem CID 142137752) has the molecular formula C17H33N3
and a molecular weight of 279.47 g/mol. Its IUPAC name is ethane;1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine.
Molecular Properties
| Compound Name | ethane;1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine |
| PubChem CID | 142137752 |
| Molecular Formula | C17H33N3 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.27 |
| IUPAC Name | ethane;1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine |
| SMILES | C=CC(=N\C=C/C)/C(=N\C)C1CCNCC1.CC.CC |
| InChI | InChI=1S/C13H21N3.2C2H6/c1-4-8-16-12(5-2)13(14-3)11-6-9-15-10-7-11;2*1-2/h4-5,8,11,15H,2,6-7,9-10H2,1,3H3;2*1-2H3/b8-4-,14-13-,16-12+;; |
| InChIKey | ABMMFZZHSSMATA-RWLFDRAOSA-N |
| XLogP | 4.27 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine?
The IUPAC name of ethane;1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine (CID 142137752) is ethane;1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine.
What is the SMILES notation for ethane;1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine?
The canonical SMILES for ethane;1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine is C=CC(=N\C=C/C)/C(=N\C)C1CCNCC1.CC.CC.
What is the InChIKey of ethane;1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine?
The InChIKey is ABMMFZZHSSMATA-RWLFDRAOSA-N. The full InChI is InChI=1S/C13H21N3.2C2H6/c1-4-8-16-12(5-2)13(14-3)11-6-9-15-10-7-11;2*1-2/h4-5,8,11,15H,2,6-7,9-10H2,1,3H3;2*1-2H3/b8-4-,14-13-,16-12+;;.
What are the key properties of ethane;1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine?
ethane;1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine has a molecular weight of 279.47 g/mol, XLogP of 4.27, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine is sourced from PubChem (CID 142137752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).