About 1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine
1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine (PubChem CID 142137753) has the molecular formula C13H21N3
and a molecular weight of 219.33 g/mol. Its IUPAC name is 1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine.
Molecular Properties
| Compound Name | 1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine |
| PubChem CID | 142137753 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine |
| SMILES | C=CC(=N\C=C/C)/C(=N\C)C1CCNCC1 |
| InChI | InChI=1S/C13H21N3/c1-4-8-16-12(5-2)13(14-3)11-6-9-15-10-7-11/h4-5,8,11,15H,2,6-7,9-10H2,1,3H3/b8-4-,14-13-,16-12+ |
| InChIKey | NJUGDJUTRTZQDS-WQYNUUHBSA-N |
| XLogP | 2.22 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine?
The IUPAC name of 1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine (CID 142137753) is 1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine.
What is the SMILES notation for 1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine?
The canonical SMILES for 1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine is C=CC(=N\C=C/C)/C(=N\C)C1CCNCC1.
What is the InChIKey of 1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine?
The InChIKey is NJUGDJUTRTZQDS-WQYNUUHBSA-N. The full InChI is InChI=1S/C13H21N3/c1-4-8-16-12(5-2)13(14-3)11-6-9-15-10-7-11/h4-5,8,11,15H,2,6-7,9-10H2,1,3H3/b8-4-,14-13-,16-12+.
What are the key properties of 1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine?
1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine has a molecular weight of 219.33 g/mol, XLogP of 2.22, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-methyl-1-piperidin-4-yl-2-N-[(Z)-prop-1-enyl]but-3-ene-1,2-diimine is sourced from PubChem (CID 142137753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).