C41H52N6O4 — CID 142137817
2-[cyano-[2-[2-[ethyl-(2-hydroxy-3-quinolin-5-yloxypropyl)amino]ethyl-methylamino]acetyl]amino]-N-(1,7-diphenylheptan-4-yl)acetamide (PubChem CID 142137817) has the molecular formula C41H52N6O4 and a molecular weight of 692.91 g/mol. Its IUPAC name is 2-[cyano-[2-[2-[ethyl-(2-hydroxy-3-quinolin-5-yloxypropyl)amino]ethyl-methylamino]acetyl]amino]-N-(1,7-diphenylheptan-4-yl)acetamide.
| Compound Name | 2-[cyano-[2-[2-[ethyl-(2-hydroxy-3-quinolin-5-yloxypropyl)amino]ethyl-methylamino]acetyl]amino]-N-(1,7-diphenylheptan-4-yl)acetamide |
|---|---|
| PubChem CID | 142137817 |
| Molecular Formula | C41H52N6O4 |
| Molecular Weight | 692.91 g/mol |
| Exact Mass | 692.41 |
| IUPAC Name | 2-[cyano-[2-[2-[ethyl-(2-hydroxy-3-quinolin-5-yloxypropyl)amino]ethyl-methylamino]acetyl]amino]-N-(1,7-diphenylheptan-4-yl)acetamide |
| SMILES | CCN(CCN(C)CC(=O)N(C#N)CC(=O)NC(CCCc1ccccc1)CCCc1ccccc1)CC(O)COc1cccc2ncccc12 |
| InChI | InChI=1S/C41H52N6O4/c1-3-46(28-36(48)31-51-39-24-12-23-38-37(39)22-13-25-43-38)27-26-45(2)30-41(50)47(32-42)29-40(49)44-35(20-10-18-33-14-6-4-7-15-33)21-11-19-34-16-8-5-9-17-34/h4-9,12-17,22-25,35-36,48H,3,10-11,18-21,26-31H2,1-2H3,(H,44,49) |
| InChIKey | MQEXBGRQWOROTD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.91 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|