C26H32N2O3S — CID 142138039
2,3-dihydro-1,4-benzoxathiin-6-amine;3-ethyl-3-methyl-1-phenoxyazetidine;phenol (PubChem CID 142138039) has the molecular formula C26H32N2O3S and a molecular weight of 452.62 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzoxathiin-6-amine;3-ethyl-3-methyl-1-phenoxyazetidine;phenol.
| Compound Name | 2,3-dihydro-1,4-benzoxathiin-6-amine;3-ethyl-3-methyl-1-phenoxyazetidine;phenol |
|---|---|
| PubChem CID | 142138039 |
| Molecular Formula | C26H32N2O3S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 2,3-dihydro-1,4-benzoxathiin-6-amine;3-ethyl-3-methyl-1-phenoxyazetidine;phenol |
| SMILES | CCC1(C)CN(Oc2ccccc2)C1.Nc1ccc2c(c1)SCCO2.Oc1ccccc1 |
| InChI | InChI=1S/C12H17NO.C8H9NOS.C6H6O/c1-3-12(2)9-13(10-12)14-11-7-5-4-6-8-11;9-6-1-2-7-8(5-6)11-4-3-10-7;7-6-4-2-1-3-5-6/h4-8H,3,9-10H2,1-2H3;1-2,5H,3-4,9H2;1-5,7H |
| InChIKey | DRWDXYLOSPHBOA-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|