C16H33NO — CID 142138355
ethane;4-[(3E)-hexa-1,3-dien-3-yl]-1-methylpiperidin-4-ol (PubChem CID 142138355) has the molecular formula C16H33NO and a molecular weight of 255.45 g/mol. Its IUPAC name is ethane;4-[(3E)-hexa-1,3-dien-3-yl]-1-methylpiperidin-4-ol.
| Compound Name | ethane;4-[(3E)-hexa-1,3-dien-3-yl]-1-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 142138355 |
| Molecular Formula | C16H33NO |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.26 |
| IUPAC Name | ethane;4-[(3E)-hexa-1,3-dien-3-yl]-1-methylpiperidin-4-ol |
| SMILES | C=C/C(=C\CC)C1(O)CCN(C)CC1.CC.CC |
| InChI | InChI=1S/C12H21NO.2C2H6/c1-4-6-11(5-2)12(14)7-9-13(3)10-8-12;2*1-2/h5-6,14H,2,4,7-10H2,1,3H3;2*1-2H3/b11-6+;; |
| InChIKey | PHILWJMNQBLCNU-QVLKBJGCSA-N |
| XLogP | 4.02 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|