C15H20O — CID 142138771
2-methyl-3-(2-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)propanal (PubChem CID 142138771) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is 2-methyl-3-(2-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)propanal.
| Compound Name | 2-methyl-3-(2-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)propanal |
|---|---|
| PubChem CID | 142138771 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 2-methyl-3-(2-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)propanal |
| SMILES | Cc1ccc2c(c1CC(C)C=O)CCCC2 |
| InChI | InChI=1S/C15H20O/c1-11(10-16)9-15-12(2)7-8-13-5-3-4-6-14(13)15/h7-8,10-11H,3-6,9H2,1-2H3 |
| InChIKey | CGXAVOPEWZCSSY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|