About 4-azido-2,3-bis(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane
4-azido-2,3-bis(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane (PubChem CID 14213909) has the molecular formula C20H21N3O4
and a molecular weight of 367.41 g/mol. Its IUPAC name is 4-azido-2,3-bis(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | 4-azido-2,3-bis(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane |
| PubChem CID | 14213909 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 4-azido-2,3-bis(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane |
| SMILES | [N-]=[N+]=NC1C2OCC(O2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C20H21N3O4/c21-23-22-17-19(25-12-15-9-5-2-6-10-15)18(16-13-26-20(17)27-16)24-11-14-7-3-1-4-8-14/h1-10,16-20H,11-13H2 |
| InChIKey | WGZHSGODUTUPCP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-azido-2,3-bis(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azido-2,3-bis(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane?
The IUPAC name of 4-azido-2,3-bis(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane (CID 14213909) is 4-azido-2,3-bis(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane.
What is the SMILES notation for 4-azido-2,3-bis(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane?
The canonical SMILES for 4-azido-2,3-bis(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane is [N-]=[N+]=NC1C2OCC(O2)C(OCc2ccccc2)C1OCc1ccccc1.
What is the InChIKey of 4-azido-2,3-bis(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane?
The InChIKey is WGZHSGODUTUPCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O4/c21-23-22-17-19(25-12-15-9-5-2-6-10-15)18(16-13-26-20(17)27-16)24-11-14-7-3-1-4-8-14/h1-10,16-20H,11-13H2.
What are the key properties of 4-azido-2,3-bis(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane?
4-azido-2,3-bis(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane has a molecular weight of 367.41 g/mol, XLogP of 3.59, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azido-2,3-bis(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane is sourced from PubChem (CID 14213909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).