C32H52N2O2 — CID 142139143
3-[[(3-butanoylphenyl)methyl-ethylamino]methyl]benzamide;ethane;nonane (PubChem CID 142139143) has the molecular formula C32H52N2O2 and a molecular weight of 496.78 g/mol. Its IUPAC name is 3-[[(3-butanoylphenyl)methyl-ethylamino]methyl]benzamide;ethane;nonane.
| Compound Name | 3-[[(3-butanoylphenyl)methyl-ethylamino]methyl]benzamide;ethane;nonane |
|---|---|
| PubChem CID | 142139143 |
| Molecular Formula | C32H52N2O2 |
| Molecular Weight | 496.78 g/mol |
| Exact Mass | 496.40 |
| IUPAC Name | 3-[[(3-butanoylphenyl)methyl-ethylamino]methyl]benzamide;ethane;nonane |
| SMILES | CC.CCCC(=O)c1cccc(CN(CC)Cc2cccc(C(N)=O)c2)c1.CCCCCCCCC |
| InChI | InChI=1S/C21H26N2O2.C9H20.C2H6/c1-3-7-20(24)18-10-5-8-16(12-18)14-23(4-2)15-17-9-6-11-19(13-17)21(22)25;1-3-5-7-9-8-6-4-2;1-2/h5-6,8-13H,3-4,7,14-15H2,1-2H3,(H2,22,25);3-9H2,1-2H3;1-2H3 |
| InChIKey | YZGHOHZDISWQPC-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.78 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|