About 5-(6,6-dimethyl-2-thiabicyclo[3.1.1]heptan-3-yl)pentanoic acid
5-(6,6-dimethyl-2-thiabicyclo[3.1.1]heptan-3-yl)pentanoic acid (PubChem CID 142139251) has the molecular formula C13H22O2S
and a molecular weight of 242.38 g/mol. Its IUPAC name is 5-(6,6-dimethyl-2-thiabicyclo[3.1.1]heptan-3-yl)pentanoic acid.
Molecular Properties
| Compound Name | 5-(6,6-dimethyl-2-thiabicyclo[3.1.1]heptan-3-yl)pentanoic acid |
| PubChem CID | 142139251 |
| Molecular Formula | C13H22O2S |
| Molecular Weight | 242.38 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 5-(6,6-dimethyl-2-thiabicyclo[3.1.1]heptan-3-yl)pentanoic acid |
| SMILES | CC1(C)C2CC(CCCCC(=O)O)SC1C2 |
| InChI | InChI=1S/C13H22O2S/c1-13(2)9-7-10(16-11(13)8-9)5-3-4-6-12(14)15/h9-11H,3-8H2,1-2H3,(H,14,15) |
| InChIKey | UPVPJUPFWWUPLW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(6,6-dimethyl-2-thiabicyclo[3.1.1]heptan-3-yl)pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(6,6-dimethyl-2-thiabicyclo[3.1.1]heptan-3-yl)pentanoic acid?
The IUPAC name of 5-(6,6-dimethyl-2-thiabicyclo[3.1.1]heptan-3-yl)pentanoic acid (CID 142139251) is 5-(6,6-dimethyl-2-thiabicyclo[3.1.1]heptan-3-yl)pentanoic acid.
What is the SMILES notation for 5-(6,6-dimethyl-2-thiabicyclo[3.1.1]heptan-3-yl)pentanoic acid?
The canonical SMILES for 5-(6,6-dimethyl-2-thiabicyclo[3.1.1]heptan-3-yl)pentanoic acid is CC1(C)C2CC(CCCCC(=O)O)SC1C2.
What is the InChIKey of 5-(6,6-dimethyl-2-thiabicyclo[3.1.1]heptan-3-yl)pentanoic acid?
The InChIKey is UPVPJUPFWWUPLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O2S/c1-13(2)9-7-10(16-11(13)8-9)5-3-4-6-12(14)15/h9-11H,3-8H2,1-2H3,(H,14,15).
What are the key properties of 5-(6,6-dimethyl-2-thiabicyclo[3.1.1]heptan-3-yl)pentanoic acid?
5-(6,6-dimethyl-2-thiabicyclo[3.1.1]heptan-3-yl)pentanoic acid has a molecular weight of 242.38 g/mol, XLogP of 3.55, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6,6-dimethyl-2-thiabicyclo[3.1.1]heptan-3-yl)pentanoic acid is sourced from PubChem (CID 142139251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).