About 2-ethenyl-2-methyl-6,6-bis(trifluoromethyl)oxane
2-ethenyl-2-methyl-6,6-bis(trifluoromethyl)oxane (PubChem CID 142139398) has the molecular formula C10H12F6O
and a molecular weight of 262.19 g/mol. Its IUPAC name is 2-ethenyl-2-methyl-6,6-bis(trifluoromethyl)oxane.
Molecular Properties
| Compound Name | 2-ethenyl-2-methyl-6,6-bis(trifluoromethyl)oxane |
| PubChem CID | 142139398 |
| Molecular Formula | C10H12F6O |
| Molecular Weight | 262.19 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 2-ethenyl-2-methyl-6,6-bis(trifluoromethyl)oxane |
| SMILES | C=CC1(C)CCCC(C(F)(F)F)(C(F)(F)F)O1 |
| InChI | InChI=1S/C10H12F6O/c1-3-7(2)5-4-6-8(17-7,9(11,12)13)10(14,15)16/h3H,1,4-6H2,2H3 |
| InChIKey | BOISNNJYRJEVFN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.19 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-2-methyl-6,6-bis(trifluoromethyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-2-methyl-6,6-bis(trifluoromethyl)oxane?
The IUPAC name of 2-ethenyl-2-methyl-6,6-bis(trifluoromethyl)oxane (CID 142139398) is 2-ethenyl-2-methyl-6,6-bis(trifluoromethyl)oxane.
What is the SMILES notation for 2-ethenyl-2-methyl-6,6-bis(trifluoromethyl)oxane?
The canonical SMILES for 2-ethenyl-2-methyl-6,6-bis(trifluoromethyl)oxane is C=CC1(C)CCCC(C(F)(F)F)(C(F)(F)F)O1.
What is the InChIKey of 2-ethenyl-2-methyl-6,6-bis(trifluoromethyl)oxane?
The InChIKey is BOISNNJYRJEVFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F6O/c1-3-7(2)5-4-6-8(17-7,9(11,12)13)10(14,15)16/h3H,1,4-6H2,2H3.
What are the key properties of 2-ethenyl-2-methyl-6,6-bis(trifluoromethyl)oxane?
2-ethenyl-2-methyl-6,6-bis(trifluoromethyl)oxane has a molecular weight of 262.19 g/mol, XLogP of 3.99, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-2-methyl-6,6-bis(trifluoromethyl)oxane is sourced from PubChem (CID 142139398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).