C19H23NO2 — CID 142139780
(2E)-2-(5-methoxy-4,6-dimethyl-2,3-dihydroinden-1-ylidene)-4,4-dimethyl-3-oxopentanenitrile (PubChem CID 142139780) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (2E)-2-(5-methoxy-4,6-dimethyl-2,3-dihydroinden-1-ylidene)-4,4-dimethyl-3-oxopentanenitrile.
| Compound Name | (2E)-2-(5-methoxy-4,6-dimethyl-2,3-dihydroinden-1-ylidene)-4,4-dimethyl-3-oxopentanenitrile |
|---|---|
| PubChem CID | 142139780 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (2E)-2-(5-methoxy-4,6-dimethyl-2,3-dihydroinden-1-ylidene)-4,4-dimethyl-3-oxopentanenitrile |
| SMILES | COc1c(C)cc2c(c1C)CC/C2=C(/C#N)C(=O)C(C)(C)C |
| InChI | InChI=1S/C19H23NO2/c1-11-9-15-13(12(2)17(11)22-6)7-8-14(15)16(10-20)18(21)19(3,4)5/h9H,7-8H2,1-6H3/b16-14+ |
| InChIKey | RJDKPQOJAHWBBF-JQIJEIRASA-N |
| XLogP | 4.15 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|