About 1-ethyl-4-(4-piperidin-1-ylbutyl)piperazine;methane;hydrate
1-ethyl-4-(4-piperidin-1-ylbutyl)piperazine;methane;hydrate (PubChem CID 142139914) has the molecular formula C17H41N3O
and a molecular weight of 303.53 g/mol. Its IUPAC name is 1-ethyl-4-(4-piperidin-1-ylbutyl)piperazine;methane;hydrate.
Molecular Properties
| Compound Name | 1-ethyl-4-(4-piperidin-1-ylbutyl)piperazine;methane;hydrate |
| PubChem CID | 142139914 |
| Molecular Formula | C17H41N3O |
| Molecular Weight | 303.53 g/mol |
| Exact Mass | 303.32 |
| IUPAC Name | 1-ethyl-4-(4-piperidin-1-ylbutyl)piperazine;methane;hydrate |
| SMILES | C.C.CCN1CCN(CCCCN2CCCCC2)CC1.O |
| InChI | InChI=1S/C15H31N3.2CH4.H2O/c1-2-16-12-14-18(15-13-16)11-7-6-10-17-8-4-3-5-9-17;;;/h2-15H2,1H3;2*1H4;1H2 |
| InChIKey | KVFSKPXKOAJBRB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 41.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.53 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4-(4-piperidin-1-ylbutyl)piperazine;methane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-(4-piperidin-1-ylbutyl)piperazine;methane;hydrate?
The IUPAC name of 1-ethyl-4-(4-piperidin-1-ylbutyl)piperazine;methane;hydrate (CID 142139914) is 1-ethyl-4-(4-piperidin-1-ylbutyl)piperazine;methane;hydrate.
What is the SMILES notation for 1-ethyl-4-(4-piperidin-1-ylbutyl)piperazine;methane;hydrate?
The canonical SMILES for 1-ethyl-4-(4-piperidin-1-ylbutyl)piperazine;methane;hydrate is C.C.CCN1CCN(CCCCN2CCCCC2)CC1.O.
What is the InChIKey of 1-ethyl-4-(4-piperidin-1-ylbutyl)piperazine;methane;hydrate?
The InChIKey is KVFSKPXKOAJBRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31N3.2CH4.H2O/c1-2-16-12-14-18(15-13-16)11-7-6-10-17-8-4-3-5-9-17;;;/h2-15H2,1H3;2*1H4;1H2.
What are the key properties of 1-ethyl-4-(4-piperidin-1-ylbutyl)piperazine;methane;hydrate?
1-ethyl-4-(4-piperidin-1-ylbutyl)piperazine;methane;hydrate has a molecular weight of 303.53 g/mol, XLogP of 2.34, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-(4-piperidin-1-ylbutyl)piperazine;methane;hydrate is sourced from PubChem (CID 142139914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).