About 7-[4-(4-fluorophenyl)phenyl]-2-methyl-5,6-dihydro-3H-pyrrolo[1,2-c]imidazol-7-ol
7-[4-(4-fluorophenyl)phenyl]-2-methyl-5,6-dihydro-3H-pyrrolo[1,2-c]imidazol-7-ol (PubChem CID 142141041) has the molecular formula C19H19FN2O
and a molecular weight of 310.37 g/mol. Its IUPAC name is 7-[4-(4-fluorophenyl)phenyl]-2-methyl-5,6-dihydro-3H-pyrrolo[1,2-c]imidazol-7-ol.
Molecular Properties
| Compound Name | 7-[4-(4-fluorophenyl)phenyl]-2-methyl-5,6-dihydro-3H-pyrrolo[1,2-c]imidazol-7-ol |
| PubChem CID | 142141041 |
| Molecular Formula | C19H19FN2O |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 7-[4-(4-fluorophenyl)phenyl]-2-methyl-5,6-dihydro-3H-pyrrolo[1,2-c]imidazol-7-ol |
| SMILES | CN1C=C2N(CCC2(O)c2ccc(-c3ccc(F)cc3)cc2)C1 |
| InChI | InChI=1S/C19H19FN2O/c1-21-12-18-19(23,10-11-22(18)13-21)16-6-2-14(3-7-16)15-4-8-17(20)9-5-15/h2-9,12,23H,10-11,13H2,1H3 |
| InChIKey | CQZRVXMGQBULIC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-[4-(4-fluorophenyl)phenyl]-2-methyl-5,6-dihydro-3H-pyrrolo[1,2-c]imidazol-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[4-(4-fluorophenyl)phenyl]-2-methyl-5,6-dihydro-3H-pyrrolo[1,2-c]imidazol-7-ol?
The IUPAC name of 7-[4-(4-fluorophenyl)phenyl]-2-methyl-5,6-dihydro-3H-pyrrolo[1,2-c]imidazol-7-ol (CID 142141041) is 7-[4-(4-fluorophenyl)phenyl]-2-methyl-5,6-dihydro-3H-pyrrolo[1,2-c]imidazol-7-ol.
What is the SMILES notation for 7-[4-(4-fluorophenyl)phenyl]-2-methyl-5,6-dihydro-3H-pyrrolo[1,2-c]imidazol-7-ol?
The canonical SMILES for 7-[4-(4-fluorophenyl)phenyl]-2-methyl-5,6-dihydro-3H-pyrrolo[1,2-c]imidazol-7-ol is CN1C=C2N(CCC2(O)c2ccc(-c3ccc(F)cc3)cc2)C1.
What is the InChIKey of 7-[4-(4-fluorophenyl)phenyl]-2-methyl-5,6-dihydro-3H-pyrrolo[1,2-c]imidazol-7-ol?
The InChIKey is CQZRVXMGQBULIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19FN2O/c1-21-12-18-19(23,10-11-22(18)13-21)16-6-2-14(3-7-16)15-4-8-17(20)9-5-15/h2-9,12,23H,10-11,13H2,1H3.
What are the key properties of 7-[4-(4-fluorophenyl)phenyl]-2-methyl-5,6-dihydro-3H-pyrrolo[1,2-c]imidazol-7-ol?
7-[4-(4-fluorophenyl)phenyl]-2-methyl-5,6-dihydro-3H-pyrrolo[1,2-c]imidazol-7-ol has a molecular weight of 310.37 g/mol, XLogP of 3.13, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[4-(4-fluorophenyl)phenyl]-2-methyl-5,6-dihydro-3H-pyrrolo[1,2-c]imidazol-7-ol is sourced from PubChem (CID 142141041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).