About benzene;5-chlorocyclohepta-1,4,6-triene-1-carbaldehyde;propan-2-yl 2-hydroxy-2-methylpropanoate
benzene;5-chlorocyclohepta-1,4,6-triene-1-carbaldehyde;propan-2-yl 2-hydroxy-2-methylpropanoate (PubChem CID 142141261) has the molecular formula C21H27ClO4
and a molecular weight of 378.90 g/mol. Its IUPAC name is benzene;5-chlorocyclohepta-1,4,6-triene-1-carbaldehyde;propan-2-yl 2-hydroxy-2-methylpropanoate.
Molecular Properties
| Compound Name | benzene;5-chlorocyclohepta-1,4,6-triene-1-carbaldehyde;propan-2-yl 2-hydroxy-2-methylpropanoate |
| PubChem CID | 142141261 |
| Molecular Formula | C21H27ClO4 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | benzene;5-chlorocyclohepta-1,4,6-triene-1-carbaldehyde;propan-2-yl 2-hydroxy-2-methylpropanoate |
| SMILES | CC(C)OC(=O)C(C)(C)O.O=CC1=CCC=C(Cl)C=C1.c1ccccc1 |
| InChI | InChI=1S/C8H7ClO.C7H14O3.C6H6/c9-8-3-1-2-7(6-10)4-5-8;1-5(2)10-6(8)7(3,4)9;1-2-4-6-5-3-1/h2-6H,1H2;5,9H,1-4H3;1-6H |
| InChIKey | RWSNZXKDHVLTSI-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze benzene;5-chlorocyclohepta-1,4,6-triene-1-carbaldehyde;propan-2-yl 2-hydroxy-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;5-chlorocyclohepta-1,4,6-triene-1-carbaldehyde;propan-2-yl 2-hydroxy-2-methylpropanoate?
The IUPAC name of benzene;5-chlorocyclohepta-1,4,6-triene-1-carbaldehyde;propan-2-yl 2-hydroxy-2-methylpropanoate (CID 142141261) is benzene;5-chlorocyclohepta-1,4,6-triene-1-carbaldehyde;propan-2-yl 2-hydroxy-2-methylpropanoate.
What is the SMILES notation for benzene;5-chlorocyclohepta-1,4,6-triene-1-carbaldehyde;propan-2-yl 2-hydroxy-2-methylpropanoate?
The canonical SMILES for benzene;5-chlorocyclohepta-1,4,6-triene-1-carbaldehyde;propan-2-yl 2-hydroxy-2-methylpropanoate is CC(C)OC(=O)C(C)(C)O.O=CC1=CCC=C(Cl)C=C1.c1ccccc1.
What is the InChIKey of benzene;5-chlorocyclohepta-1,4,6-triene-1-carbaldehyde;propan-2-yl 2-hydroxy-2-methylpropanoate?
The InChIKey is RWSNZXKDHVLTSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClO.C7H14O3.C6H6/c9-8-3-1-2-7(6-10)4-5-8;1-5(2)10-6(8)7(3,4)9;1-2-4-6-5-3-1/h2-6H,1H2;5,9H,1-4H3;1-6H.
What are the key properties of benzene;5-chlorocyclohepta-1,4,6-triene-1-carbaldehyde;propan-2-yl 2-hydroxy-2-methylpropanoate?
benzene;5-chlorocyclohepta-1,4,6-triene-1-carbaldehyde;propan-2-yl 2-hydroxy-2-methylpropanoate has a molecular weight of 378.90 g/mol, XLogP of 4.59, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;5-chlorocyclohepta-1,4,6-triene-1-carbaldehyde;propan-2-yl 2-hydroxy-2-methylpropanoate is sourced from PubChem (CID 142141261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).