About (E)-2-(2,5-dimethylhex-1-en-3-ylamino)-4-ethyl-7-(4-methylcyclohexen-1-yl)oct-6-en-1-ol
(E)-2-(2,5-dimethylhex-1-en-3-ylamino)-4-ethyl-7-(4-methylcyclohexen-1-yl)oct-6-en-1-ol (PubChem CID 142141543) has the molecular formula C25H45NO
and a molecular weight of 375.64 g/mol. Its IUPAC name is (E)-2-(2,5-dimethylhex-1-en-3-ylamino)-4-ethyl-7-(4-methylcyclohexen-1-yl)oct-6-en-1-ol.
Molecular Properties
| Compound Name | (E)-2-(2,5-dimethylhex-1-en-3-ylamino)-4-ethyl-7-(4-methylcyclohexen-1-yl)oct-6-en-1-ol |
| PubChem CID | 142141543 |
| Molecular Formula | C25H45NO |
| Molecular Weight | 375.64 g/mol |
| Exact Mass | 375.35 |
| IUPAC Name | (E)-2-(2,5-dimethylhex-1-en-3-ylamino)-4-ethyl-7-(4-methylcyclohexen-1-yl)oct-6-en-1-ol |
| SMILES | C=C(C)C(CC(C)C)NC(CO)CC(CC)C/C=C(\C)C1=CCC(C)CC1 |
| InChI | InChI=1S/C25H45NO/c1-8-22(12-11-21(7)23-13-9-20(6)10-14-23)16-24(17-27)26-25(19(4)5)15-18(2)3/h11,13,18,20,22,24-27H,4,8-10,12,14-17H2,1-3,5-7H3/b21-11+ |
| InChIKey | CZSXUQDEJKGNNE-SRZZPIQSSA-N |
| XLogP | 6.43 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.64 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-(2,5-dimethylhex-1-en-3-ylamino)-4-ethyl-7-(4-methylcyclohexen-1-yl)oct-6-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-(2,5-dimethylhex-1-en-3-ylamino)-4-ethyl-7-(4-methylcyclohexen-1-yl)oct-6-en-1-ol?
The IUPAC name of (E)-2-(2,5-dimethylhex-1-en-3-ylamino)-4-ethyl-7-(4-methylcyclohexen-1-yl)oct-6-en-1-ol (CID 142141543) is (E)-2-(2,5-dimethylhex-1-en-3-ylamino)-4-ethyl-7-(4-methylcyclohexen-1-yl)oct-6-en-1-ol.
What is the SMILES notation for (E)-2-(2,5-dimethylhex-1-en-3-ylamino)-4-ethyl-7-(4-methylcyclohexen-1-yl)oct-6-en-1-ol?
The canonical SMILES for (E)-2-(2,5-dimethylhex-1-en-3-ylamino)-4-ethyl-7-(4-methylcyclohexen-1-yl)oct-6-en-1-ol is C=C(C)C(CC(C)C)NC(CO)CC(CC)C/C=C(\C)C1=CCC(C)CC1.
What is the InChIKey of (E)-2-(2,5-dimethylhex-1-en-3-ylamino)-4-ethyl-7-(4-methylcyclohexen-1-yl)oct-6-en-1-ol?
The InChIKey is CZSXUQDEJKGNNE-SRZZPIQSSA-N. The full InChI is InChI=1S/C25H45NO/c1-8-22(12-11-21(7)23-13-9-20(6)10-14-23)16-24(17-27)26-25(19(4)5)15-18(2)3/h11,13,18,20,22,24-27H,4,8-10,12,14-17H2,1-3,5-7H3/b21-11+.
What are the key properties of (E)-2-(2,5-dimethylhex-1-en-3-ylamino)-4-ethyl-7-(4-methylcyclohexen-1-yl)oct-6-en-1-ol?
(E)-2-(2,5-dimethylhex-1-en-3-ylamino)-4-ethyl-7-(4-methylcyclohexen-1-yl)oct-6-en-1-ol has a molecular weight of 375.64 g/mol, XLogP of 6.43, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-(2,5-dimethylhex-1-en-3-ylamino)-4-ethyl-7-(4-methylcyclohexen-1-yl)oct-6-en-1-ol is sourced from PubChem (CID 142141543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).