C34H53FN4O — CID 142142001
1-[(E)-3-amino-1-[[4-ethyl-3-[(E)-1-ethylprop-1-enyl]-5-[(2-fluorophenyl)methyl]hept-3-en-2-ylidene]amino]but-1-en-2-yl]-5-methylpyrrolidin-2-one;ethenamine;ethene (PubChem CID 142142001) has the molecular formula C34H53FN4O and a molecular weight of 552.82 g/mol. Its IUPAC name is 1-[(E)-3-amino-1-[[4-ethyl-3-[(E)-1-ethylprop-1-enyl]-5-[(2-fluorophenyl)methyl]hept-3-en-2-ylidene]amino]but-1-en-2-yl]-5-methylpyrrolidin-2-one;ethenamine;ethene.
| Compound Name | 1-[(E)-3-amino-1-[[4-ethyl-3-[(E)-1-ethylprop-1-enyl]-5-[(2-fluorophenyl)methyl]hept-3-en-2-ylidene]amino]but-1-en-2-yl]-5-methylpyrrolidin-2-one;ethenamine;ethene |
|---|---|
| PubChem CID | 142142001 |
| Molecular Formula | C34H53FN4O |
| Molecular Weight | 552.82 g/mol |
| Exact Mass | 552.42 |
| IUPAC Name | 1-[(E)-3-amino-1-[[4-ethyl-3-[(E)-1-ethylprop-1-enyl]-5-[(2-fluorophenyl)methyl]hept-3-en-2-ylidene]amino]but-1-en-2-yl]-5-methylpyrrolidin-2-one;ethenamine;ethene |
| SMILES | C/C=C(\CC)C(=C(CC)C(CC)Cc1ccccc1F)/C(C)=N/C=C(\C(C)N)N1C(=O)CCC1C.C=C.C=CN |
| InChI | InChI=1S/C30H44FN3O.C2H5N.C2H4/c1-8-23(9-2)30(26(11-4)24(10-3)18-25-14-12-13-15-27(25)31)22(7)33-19-28(21(6)32)34-20(5)16-17-29(34)35;1-2-3;1-2/h8,12-15,19-21,24H,9-11,16-18,32H2,1-7H3;2H,1,3H2;1-2H2/b23-8+,28-19+,30-26?,33-22+;; |
| InChIKey | CPXKMVYMPJHBQX-GBJXGFEZSA-N |
| XLogP | 8.01 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.82 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|