C11H17ClF3N — CID 142143157
(2E,4Z)-6-chloro-N-methyl-5-(trifluoromethyl)hepta-2,4,6-trien-3-amine;ethane (PubChem CID 142143157) has the molecular formula C11H17ClF3N and a molecular weight of 255.71 g/mol. Its IUPAC name is (2E,4Z)-6-chloro-N-methyl-5-(trifluoromethyl)hepta-2,4,6-trien-3-amine;ethane.
| Compound Name | (2E,4Z)-6-chloro-N-methyl-5-(trifluoromethyl)hepta-2,4,6-trien-3-amine;ethane |
|---|---|
| PubChem CID | 142143157 |
| Molecular Formula | C11H17ClF3N |
| Molecular Weight | 255.71 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | (2E,4Z)-6-chloro-N-methyl-5-(trifluoromethyl)hepta-2,4,6-trien-3-amine;ethane |
| SMILES | C=C(Cl)/C(=C\C(=C/C)NC)C(F)(F)F.CC |
| InChI | InChI=1S/C9H11ClF3N.C2H6/c1-4-7(14-3)5-8(6(2)10)9(11,12)13;1-2/h4-5,14H,2H2,1,3H3;1-2H3/b7-4-,8-5+; |
| InChIKey | LJVXQMSARHLOAO-QMKOBIDDSA-N |
| XLogP | 4.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.71 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|