About [1-(methylamino)cyclohexyl]-(4-methylpiperazin-1-yl)methanone;2-methylcyclohexa-1,3-diene
[1-(methylamino)cyclohexyl]-(4-methylpiperazin-1-yl)methanone;2-methylcyclohexa-1,3-diene (PubChem CID 142143269) has the molecular formula C20H35N3O
and a molecular weight of 333.52 g/mol. Its IUPAC name is [1-(methylamino)cyclohexyl]-(4-methylpiperazin-1-yl)methanone;2-methylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | [1-(methylamino)cyclohexyl]-(4-methylpiperazin-1-yl)methanone;2-methylcyclohexa-1,3-diene |
| PubChem CID | 142143269 |
| Molecular Formula | C20H35N3O |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.28 |
| IUPAC Name | [1-(methylamino)cyclohexyl]-(4-methylpiperazin-1-yl)methanone;2-methylcyclohexa-1,3-diene |
| SMILES | CC1=CCCC=C1.CNC1(C(=O)N2CCN(C)CC2)CCCCC1 |
| InChI | InChI=1S/C13H25N3O.C7H10/c1-14-13(6-4-3-5-7-13)12(17)16-10-8-15(2)9-11-16;1-7-5-3-2-4-6-7/h14H,3-11H2,1-2H3;3,5-6H,2,4H2,1H3 |
| InChIKey | QJJWDCQHDJDJJE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(methylamino)cyclohexyl]-(4-methylpiperazin-1-yl)methanone;2-methylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(methylamino)cyclohexyl]-(4-methylpiperazin-1-yl)methanone;2-methylcyclohexa-1,3-diene?
The IUPAC name of [1-(methylamino)cyclohexyl]-(4-methylpiperazin-1-yl)methanone;2-methylcyclohexa-1,3-diene (CID 142143269) is [1-(methylamino)cyclohexyl]-(4-methylpiperazin-1-yl)methanone;2-methylcyclohexa-1,3-diene.
What is the SMILES notation for [1-(methylamino)cyclohexyl]-(4-methylpiperazin-1-yl)methanone;2-methylcyclohexa-1,3-diene?
The canonical SMILES for [1-(methylamino)cyclohexyl]-(4-methylpiperazin-1-yl)methanone;2-methylcyclohexa-1,3-diene is CC1=CCCC=C1.CNC1(C(=O)N2CCN(C)CC2)CCCCC1.
What is the InChIKey of [1-(methylamino)cyclohexyl]-(4-methylpiperazin-1-yl)methanone;2-methylcyclohexa-1,3-diene?
The InChIKey is QJJWDCQHDJDJJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3O.C7H10/c1-14-13(6-4-3-5-7-13)12(17)16-10-8-15(2)9-11-16;1-7-5-3-2-4-6-7/h14H,3-11H2,1-2H3;3,5-6H,2,4H2,1H3.
What are the key properties of [1-(methylamino)cyclohexyl]-(4-methylpiperazin-1-yl)methanone;2-methylcyclohexa-1,3-diene?
[1-(methylamino)cyclohexyl]-(4-methylpiperazin-1-yl)methanone;2-methylcyclohexa-1,3-diene has a molecular weight of 333.52 g/mol, XLogP of 2.97, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(methylamino)cyclohexyl]-(4-methylpiperazin-1-yl)methanone;2-methylcyclohexa-1,3-diene is sourced from PubChem (CID 142143269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).