C25H28ClN3O3 — CID 142143781
4-chloro-7-(2-morpholin-4-ylethoxy)-6-phenylmethoxyquinoline-3-carbonitrile;ethane (PubChem CID 142143781) has the molecular formula C25H28ClN3O3 and a molecular weight of 453.97 g/mol. Its IUPAC name is 4-chloro-7-(2-morpholin-4-ylethoxy)-6-phenylmethoxyquinoline-3-carbonitrile;ethane.
| Compound Name | 4-chloro-7-(2-morpholin-4-ylethoxy)-6-phenylmethoxyquinoline-3-carbonitrile;ethane |
|---|---|
| PubChem CID | 142143781 |
| Molecular Formula | C25H28ClN3O3 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 4-chloro-7-(2-morpholin-4-ylethoxy)-6-phenylmethoxyquinoline-3-carbonitrile;ethane |
| SMILES | CC.N#Cc1cnc2cc(OCCN3CCOCC3)c(OCc3ccccc3)cc2c1Cl |
| InChI | InChI=1S/C23H22ClN3O3.C2H6/c24-23-18(14-25)15-26-20-13-22(29-11-8-27-6-9-28-10-7-27)21(12-19(20)23)30-16-17-4-2-1-3-5-17;1-2/h1-5,12-13,15H,6-11,16H2;1-2H3 |
| InChIKey | AWDKSSMDNBEHAK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 67.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |