About 4-[(Z)-1-(2,4-dimethylphenyl)prop-1-enyl]morpholine;ethane
4-[(Z)-1-(2,4-dimethylphenyl)prop-1-enyl]morpholine;ethane (PubChem CID 142144914) has the molecular formula C17H27NO
and a molecular weight of 261.41 g/mol. Its IUPAC name is 4-[(Z)-1-(2,4-dimethylphenyl)prop-1-enyl]morpholine;ethane.
Molecular Properties
| Compound Name | 4-[(Z)-1-(2,4-dimethylphenyl)prop-1-enyl]morpholine;ethane |
| PubChem CID | 142144914 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 4-[(Z)-1-(2,4-dimethylphenyl)prop-1-enyl]morpholine;ethane |
| SMILES | C/C=C(/c1ccc(C)cc1C)N1CCOCC1.CC |
| InChI | InChI=1S/C15H21NO.C2H6/c1-4-15(16-7-9-17-10-8-16)14-6-5-12(2)11-13(14)3;1-2/h4-6,11H,7-10H2,1-3H3;1-2H3/b15-4-; |
| InChIKey | BIYPFPJSZBMBLO-PZAJBRPHSA-N |
| XLogP | 4.02 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(Z)-1-(2,4-dimethylphenyl)prop-1-enyl]morpholine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-1-(2,4-dimethylphenyl)prop-1-enyl]morpholine;ethane?
The IUPAC name of 4-[(Z)-1-(2,4-dimethylphenyl)prop-1-enyl]morpholine;ethane (CID 142144914) is 4-[(Z)-1-(2,4-dimethylphenyl)prop-1-enyl]morpholine;ethane.
What is the SMILES notation for 4-[(Z)-1-(2,4-dimethylphenyl)prop-1-enyl]morpholine;ethane?
The canonical SMILES for 4-[(Z)-1-(2,4-dimethylphenyl)prop-1-enyl]morpholine;ethane is C/C=C(/c1ccc(C)cc1C)N1CCOCC1.CC.
What is the InChIKey of 4-[(Z)-1-(2,4-dimethylphenyl)prop-1-enyl]morpholine;ethane?
The InChIKey is BIYPFPJSZBMBLO-PZAJBRPHSA-N. The full InChI is InChI=1S/C15H21NO.C2H6/c1-4-15(16-7-9-17-10-8-16)14-6-5-12(2)11-13(14)3;1-2/h4-6,11H,7-10H2,1-3H3;1-2H3/b15-4-;.
What are the key properties of 4-[(Z)-1-(2,4-dimethylphenyl)prop-1-enyl]morpholine;ethane?
4-[(Z)-1-(2,4-dimethylphenyl)prop-1-enyl]morpholine;ethane has a molecular weight of 261.41 g/mol, XLogP of 4.02, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-1-(2,4-dimethylphenyl)prop-1-enyl]morpholine;ethane is sourced from PubChem (CID 142144914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).