C11H16N2S — CID 142145332
2-butylsulfanyl-1-N-methylcyclohexa-2,5-diene-1,4-diimine (PubChem CID 142145332) has the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. Its IUPAC name is 2-butylsulfanyl-1-N-methylcyclohexa-2,5-diene-1,4-diimine.
| Compound Name | 2-butylsulfanyl-1-N-methylcyclohexa-2,5-diene-1,4-diimine |
|---|---|
| PubChem CID | 142145332 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2-butylsulfanyl-1-N-methylcyclohexa-2,5-diene-1,4-diimine |
| SMILES | [H]/N=C1\C=C/C(=N\C)C(SCCCC)=C1 |
| InChI | InChI=1S/C11H16N2S/c1-3-4-7-14-11-8-9(12)5-6-10(11)13-2/h5-6,8,12H,3-4,7H2,1-2H3/b12-9+,13-10+ |
| InChIKey | SOAMMUGLKIGWCM-JOWSBRCASA-N |
| XLogP | 3.06 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|