C29H34Cl2N6O3S — CID 142145470
N-(1-chloroethyl)-2-[4-[4-[[4-[4-(2-chloro-3-hydroxy-2-methylpropyl)sulfanylphenyl]pyrimidin-2-yl]amino]benzoyl]piperazin-1-yl]acetamide (PubChem CID 142145470) has the molecular formula C29H34Cl2N6O3S and a molecular weight of 617.60 g/mol. Its IUPAC name is N-(1-chloroethyl)-2-[4-[4-[[4-[4-(2-chloro-3-hydroxy-2-methylpropyl)sulfanylphenyl]pyrimidin-2-yl]amino]benzoyl]piperazin-1-yl]acetamide.
| Compound Name | N-(1-chloroethyl)-2-[4-[4-[[4-[4-(2-chloro-3-hydroxy-2-methylpropyl)sulfanylphenyl]pyrimidin-2-yl]amino]benzoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 142145470 |
| Molecular Formula | C29H34Cl2N6O3S |
| Molecular Weight | 617.60 g/mol |
| Exact Mass | 616.18 |
| IUPAC Name | N-(1-chloroethyl)-2-[4-[4-[[4-[4-(2-chloro-3-hydroxy-2-methylpropyl)sulfanylphenyl]pyrimidin-2-yl]amino]benzoyl]piperazin-1-yl]acetamide |
| SMILES | CC(Cl)NC(=O)CN1CCN(C(=O)c2ccc(Nc3nccc(-c4ccc(SCC(C)(Cl)CO)cc4)n3)cc2)CC1 |
| InChI | InChI=1S/C29H34Cl2N6O3S/c1-20(30)33-26(39)17-36-13-15-37(16-14-36)27(40)22-3-7-23(8-4-22)34-28-32-12-11-25(35-28)21-5-9-24(10-6-21)41-19-29(2,31)18-38/h3-12,20,38H,13-19H2,1-2H3,(H,33,39)(H,32,34,35) |
| InChIKey | SWTFYQCZSYWGHD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.60 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|