C30H34N6O3S — CID 142145553
N-methyl-4-[2-[[(3Z,5E)-5-(4-methylpiperazine-1-carbonyl)hepta-1,3,5-trien-2-yl]amino]pyrimidin-4-yl]-N-phenylbenzenesulfonamide (PubChem CID 142145553) has the molecular formula C30H34N6O3S and a molecular weight of 558.71 g/mol. Its IUPAC name is N-methyl-4-[2-[[(3Z,5E)-5-(4-methylpiperazine-1-carbonyl)hepta-1,3,5-trien-2-yl]amino]pyrimidin-4-yl]-N-phenylbenzenesulfonamide.
| Compound Name | N-methyl-4-[2-[[(3Z,5E)-5-(4-methylpiperazine-1-carbonyl)hepta-1,3,5-trien-2-yl]amino]pyrimidin-4-yl]-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 142145553 |
| Molecular Formula | C30H34N6O3S |
| Molecular Weight | 558.71 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | N-methyl-4-[2-[[(3Z,5E)-5-(4-methylpiperazine-1-carbonyl)hepta-1,3,5-trien-2-yl]amino]pyrimidin-4-yl]-N-phenylbenzenesulfonamide |
| SMILES | C=C(/C=C\C(=C/C)C(=O)N1CCN(C)CC1)Nc1nccc(-c2ccc(S(=O)(=O)N(C)c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C30H34N6O3S/c1-5-24(29(37)36-21-19-34(3)20-22-36)12-11-23(2)32-30-31-18-17-28(33-30)25-13-15-27(16-14-25)40(38,39)35(4)26-9-7-6-8-10-26/h5-18H,2,19-22H2,1,3-4H3,(H,31,32,33)/b12-11-,24-5+ |
| InChIKey | KHCSUZFFKMNAKA-UEHABJLOSA-N |
| XLogP | 4.17 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.71 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|