C17H33NO3S — CID 142146351
(3,10,10-triethyl-8,8-dimethyl-9-sulfanyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methanol (PubChem CID 142146351) has the molecular formula C17H33NO3S and a molecular weight of 331.52 g/mol. Its IUPAC name is (3,10,10-triethyl-8,8-dimethyl-9-sulfanyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methanol.
| Compound Name | (3,10,10-triethyl-8,8-dimethyl-9-sulfanyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methanol |
|---|---|
| PubChem CID | 142146351 |
| Molecular Formula | C17H33NO3S |
| Molecular Weight | 331.52 g/mol |
| Exact Mass | 331.22 |
| IUPAC Name | (3,10,10-triethyl-8,8-dimethyl-9-sulfanyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methanol |
| SMILES | CCC1(CO)COC2(CC(C)(C)N(S)C(CC)(CC)C2)OC1 |
| InChI | InChI=1S/C17H33NO3S/c1-6-15(11-19)12-20-17(21-13-15)9-14(4,5)18(22)16(7-2,8-3)10-17/h19,22H,6-13H2,1-5H3 |
| InChIKey | PTVQRWJGIARHHQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|