C21H29N3O2 — CID 142146548
[2-[(3E)-3,6-dimethylhepta-1,3,5-trien-2-yl]imino-1,6-dimethyl-4-pyridinyl]-morpholin-4-ylmethanone (PubChem CID 142146548) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is [2-[(3E)-3,6-dimethylhepta-1,3,5-trien-2-yl]imino-1,6-dimethyl-4-pyridinyl]-morpholin-4-ylmethanone.
| Compound Name | [2-[(3E)-3,6-dimethylhepta-1,3,5-trien-2-yl]imino-1,6-dimethyl-4-pyridinyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 142146548 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | [2-[(3E)-3,6-dimethylhepta-1,3,5-trien-2-yl]imino-1,6-dimethyl-4-pyridinyl]-morpholin-4-ylmethanone |
| SMILES | C=C(/N=c1\cc(C(=O)N2CCOCC2)cc(C)n1C)/C(C)=C/C=C(C)C |
| InChI | InChI=1S/C21H29N3O2/c1-15(2)7-8-16(3)18(5)22-20-14-19(13-17(4)23(20)6)21(25)24-9-11-26-12-10-24/h7-8,13-14H,5,9-12H2,1-4,6H3/b16-8+,22-20+ |
| InChIKey | CRHNWFRFUDOMSL-DOUDJLCISA-N |
| XLogP | 3.13 |
| TPSA | 46.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|