C13H15NS — CID 142146926
2-methyl-5-[(1E,3Z,6Z)-5-methylcycloocta-1,3,6-trien-1-yl]-1,3-thiazole (PubChem CID 142146926) has the molecular formula C13H15NS and a molecular weight of 217.34 g/mol. Its IUPAC name is 2-methyl-5-[(1E,3Z,6Z)-5-methylcycloocta-1,3,6-trien-1-yl]-1,3-thiazole.
| Compound Name | 2-methyl-5-[(1E,3Z,6Z)-5-methylcycloocta-1,3,6-trien-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 142146926 |
| Molecular Formula | C13H15NS |
| Molecular Weight | 217.34 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2-methyl-5-[(1E,3Z,6Z)-5-methylcycloocta-1,3,6-trien-1-yl]-1,3-thiazole |
| SMILES | Cc1ncc(/C2=C/C=C\C(C)/C=C\C2)s1 |
| InChI | InChI=1S/C13H15NS/c1-10-5-3-7-12(8-4-6-10)13-9-14-11(2)15-13/h3-7,9-10H,8H2,1-2H3/b5-3-,6-4-,12-7+ |
| InChIKey | SVAGWSCRNQXSBY-WFYFVCBASA-N |
| XLogP | 3.99 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|