C17H25NO3 — CID 142147648
(4R)-4-[(1E,3Z,5E)-6-cyclopentyloxy-1-methoxyhepta-1,3,5-trien-4-yl]pyrrolidin-2-one (PubChem CID 142147648) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is (4R)-4-[(1E,3Z,5E)-6-cyclopentyloxy-1-methoxyhepta-1,3,5-trien-4-yl]pyrrolidin-2-one.
| Compound Name | (4R)-4-[(1E,3Z,5E)-6-cyclopentyloxy-1-methoxyhepta-1,3,5-trien-4-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 142147648 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (4R)-4-[(1E,3Z,5E)-6-cyclopentyloxy-1-methoxyhepta-1,3,5-trien-4-yl]pyrrolidin-2-one |
| SMILES | CO/C=C/C=C(\C=C(/C)OC1CCCC1)[C@@H]1CNC(=O)C1 |
| InChI | InChI=1S/C17H25NO3/c1-13(21-16-7-3-4-8-16)10-14(6-5-9-20-2)15-11-17(19)18-12-15/h5-6,9-10,15-16H,3-4,7-8,11-12H2,1-2H3,(H,18,19)/b9-5+,13-10+,14-6+/t15-/m0/s1 |
| InChIKey | OLCRKTYXLOKZMH-BSPTYPQOSA-N |
| XLogP | 3.07 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|