About 3-methoxy-N-methyl-N-prop-2-enylpropan-1-amine;(Z)-pent-2-ene
3-methoxy-N-methyl-N-prop-2-enylpropan-1-amine;(Z)-pent-2-ene (PubChem CID 142148052) has the molecular formula C13H27NO
and a molecular weight of 213.36 g/mol. Its IUPAC name is 3-methoxy-N-methyl-N-prop-2-enylpropan-1-amine;(Z)-pent-2-ene.
Molecular Properties
| Compound Name | 3-methoxy-N-methyl-N-prop-2-enylpropan-1-amine;(Z)-pent-2-ene |
| PubChem CID | 142148052 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 3-methoxy-N-methyl-N-prop-2-enylpropan-1-amine;(Z)-pent-2-ene |
| SMILES | C/C=C\CC.C=CCN(C)CCCOC |
| InChI | InChI=1S/C8H17NO.C5H10/c1-4-6-9(2)7-5-8-10-3;1-3-5-4-2/h4H,1,5-8H2,2-3H3;3,5H,4H2,1-2H3/b;5-3- |
| InChIKey | SQVPFKXQTIJKLZ-PJAIOPLOSA-N |
| XLogP | 3.11 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-N-methyl-N-prop-2-enylpropan-1-amine;(Z)-pent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-N-methyl-N-prop-2-enylpropan-1-amine;(Z)-pent-2-ene?
The IUPAC name of 3-methoxy-N-methyl-N-prop-2-enylpropan-1-amine;(Z)-pent-2-ene (CID 142148052) is 3-methoxy-N-methyl-N-prop-2-enylpropan-1-amine;(Z)-pent-2-ene.
What is the SMILES notation for 3-methoxy-N-methyl-N-prop-2-enylpropan-1-amine;(Z)-pent-2-ene?
The canonical SMILES for 3-methoxy-N-methyl-N-prop-2-enylpropan-1-amine;(Z)-pent-2-ene is C/C=C\CC.C=CCN(C)CCCOC.
What is the InChIKey of 3-methoxy-N-methyl-N-prop-2-enylpropan-1-amine;(Z)-pent-2-ene?
The InChIKey is SQVPFKXQTIJKLZ-PJAIOPLOSA-N. The full InChI is InChI=1S/C8H17NO.C5H10/c1-4-6-9(2)7-5-8-10-3;1-3-5-4-2/h4H,1,5-8H2,2-3H3;3,5H,4H2,1-2H3/b;5-3-.
What are the key properties of 3-methoxy-N-methyl-N-prop-2-enylpropan-1-amine;(Z)-pent-2-ene?
3-methoxy-N-methyl-N-prop-2-enylpropan-1-amine;(Z)-pent-2-ene has a molecular weight of 213.36 g/mol, XLogP of 3.11, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-N-methyl-N-prop-2-enylpropan-1-amine;(Z)-pent-2-ene is sourced from PubChem (CID 142148052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).