C33H43N3O2 — CID 142148522
N'-[(E)-4-[1,3-benzodioxol-5-ylmethyl(benzyl)amino]but-2-en-2-yl]-N-butyl-N-methylbenzenecarboximidamide;ethane (PubChem CID 142148522) has the molecular formula C33H43N3O2 and a molecular weight of 513.73 g/mol. Its IUPAC name is N'-[(E)-4-[1,3-benzodioxol-5-ylmethyl(benzyl)amino]but-2-en-2-yl]-N-butyl-N-methylbenzenecarboximidamide;ethane.
| Compound Name | N'-[(E)-4-[1,3-benzodioxol-5-ylmethyl(benzyl)amino]but-2-en-2-yl]-N-butyl-N-methylbenzenecarboximidamide;ethane |
|---|---|
| PubChem CID | 142148522 |
| Molecular Formula | C33H43N3O2 |
| Molecular Weight | 513.73 g/mol |
| Exact Mass | 513.34 |
| IUPAC Name | N'-[(E)-4-[1,3-benzodioxol-5-ylmethyl(benzyl)amino]but-2-en-2-yl]-N-butyl-N-methylbenzenecarboximidamide;ethane |
| SMILES | CC.CCCCN(C)/C(=N\C(C)=C\CN(Cc1ccccc1)Cc1ccc2c(c1)OCO2)c1ccccc1 |
| InChI | InChI=1S/C31H37N3O2.C2H6/c1-4-5-19-33(3)31(28-14-10-7-11-15-28)32-25(2)18-20-34(22-26-12-8-6-9-13-26)23-27-16-17-29-30(21-27)36-24-35-29;1-2/h6-18,21H,4-5,19-20,22-24H2,1-3H3;1-2H3/b25-18+,32-31-; |
| InChIKey | VLBBRBKNFXMBCH-KXQIDEATSA-N |
| XLogP | 7.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.73 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|