About 2-(1,2-dimethyl-3-oxamoylbenzo[f]indol-4-yl)oxyacetic acid;1-fluoro-2-methylbenzene
2-(1,2-dimethyl-3-oxamoylbenzo[f]indol-4-yl)oxyacetic acid;1-fluoro-2-methylbenzene (PubChem CID 142148592) has the molecular formula C25H23FN2O5
and a molecular weight of 450.47 g/mol. Its IUPAC name is 2-(1,2-dimethyl-3-oxamoylbenzo[f]indol-4-yl)oxyacetic acid;1-fluoro-2-methylbenzene.
Molecular Properties
| Compound Name | 2-(1,2-dimethyl-3-oxamoylbenzo[f]indol-4-yl)oxyacetic acid;1-fluoro-2-methylbenzene |
| PubChem CID | 142148592 |
| Molecular Formula | C25H23FN2O5 |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 2-(1,2-dimethyl-3-oxamoylbenzo[f]indol-4-yl)oxyacetic acid;1-fluoro-2-methylbenzene |
| SMILES | Cc1c(C(=O)C(N)=O)c2c(OCC(=O)O)c3ccccc3cc2n1C.Cc1ccccc1F |
| InChI | InChI=1S/C18H16N2O5.C7H7F/c1-9-14(16(23)18(19)24)15-12(20(9)2)7-10-5-3-4-6-11(10)17(15)25-8-13(21)22;1-6-4-2-3-5-7(6)8/h3-7H,8H2,1-2H3,(H2,19,24)(H,21,22);2-5H,1H3 |
| InChIKey | SUPNUNYJKBPIGQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 111.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,2-dimethyl-3-oxamoylbenzo[f]indol-4-yl)oxyacetic acid;1-fluoro-2-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2-dimethyl-3-oxamoylbenzo[f]indol-4-yl)oxyacetic acid;1-fluoro-2-methylbenzene?
The IUPAC name of 2-(1,2-dimethyl-3-oxamoylbenzo[f]indol-4-yl)oxyacetic acid;1-fluoro-2-methylbenzene (CID 142148592) is 2-(1,2-dimethyl-3-oxamoylbenzo[f]indol-4-yl)oxyacetic acid;1-fluoro-2-methylbenzene.
What is the SMILES notation for 2-(1,2-dimethyl-3-oxamoylbenzo[f]indol-4-yl)oxyacetic acid;1-fluoro-2-methylbenzene?
The canonical SMILES for 2-(1,2-dimethyl-3-oxamoylbenzo[f]indol-4-yl)oxyacetic acid;1-fluoro-2-methylbenzene is Cc1c(C(=O)C(N)=O)c2c(OCC(=O)O)c3ccccc3cc2n1C.Cc1ccccc1F.
What is the InChIKey of 2-(1,2-dimethyl-3-oxamoylbenzo[f]indol-4-yl)oxyacetic acid;1-fluoro-2-methylbenzene?
The InChIKey is SUPNUNYJKBPIGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O5.C7H7F/c1-9-14(16(23)18(19)24)15-12(20(9)2)7-10-5-3-4-6-11(10)17(15)25-8-13(21)22;1-6-4-2-3-5-7(6)8/h3-7H,8H2,1-2H3,(H2,19,24)(H,21,22);2-5H,1H3.
What are the key properties of 2-(1,2-dimethyl-3-oxamoylbenzo[f]indol-4-yl)oxyacetic acid;1-fluoro-2-methylbenzene?
2-(1,2-dimethyl-3-oxamoylbenzo[f]indol-4-yl)oxyacetic acid;1-fluoro-2-methylbenzene has a molecular weight of 450.47 g/mol, XLogP of 3.91, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-dimethyl-3-oxamoylbenzo[f]indol-4-yl)oxyacetic acid;1-fluoro-2-methylbenzene is sourced from PubChem (CID 142148592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).