C25H44O6Sn — CID 14214924
[(3Z,3aS,5S,6R,7aS)-5-acetyloxy-3-(tributylstannylmethylidene)-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran-6-yl]methyl acetate (PubChem CID 14214924) has the molecular formula C25H44O6Sn and a molecular weight of 559.33 g/mol. Its IUPAC name is [(3Z,3aS,5S,6R,7aS)-5-acetyloxy-3-(tributylstannylmethylidene)-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran-6-yl]methyl acetate.
| Compound Name | [(3Z,3aS,5S,6R,7aS)-5-acetyloxy-3-(tributylstannylmethylidene)-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran-6-yl]methyl acetate |
|---|---|
| PubChem CID | 14214924 |
| Molecular Formula | C25H44O6Sn |
| Molecular Weight | 559.33 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | [(3Z,3aS,5S,6R,7aS)-5-acetyloxy-3-(tributylstannylmethylidene)-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran-6-yl]methyl acetate |
| SMILES | CCCC[Sn](/C=C1\CO[C@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)C[C@@H]12)(CCCC)CCCC |
| InChI | InChI=1S/C13H17O6.3C4H9.Sn/c1-7-5-17-13-10(7)4-11(18-9(3)15)12(19-13)6-16-8(2)14;3*1-3-4-2;/h1,10-13H,4-6H2,2-3H3;3*1,3-4H2,2H3;/t10-,11-,12+,13-;;;;/m0..../s1 |
| InChIKey | WRAXODFOPIBWQL-NKXLSOAQSA-N |
| XLogP | 5.56 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.33 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |