C11H11FN2 — CID 142149444
N'-ethenyl-2-(3-fluorocyclohepta-1,3,5,6-tetraen-1-yl)ethanimidamide (PubChem CID 142149444) has the molecular formula C11H11FN2 and a molecular weight of 190.22 g/mol. Its IUPAC name is N'-ethenyl-2-(3-fluorocyclohepta-1,3,5,6-tetraen-1-yl)ethanimidamide.
| Compound Name | N'-ethenyl-2-(3-fluorocyclohepta-1,3,5,6-tetraen-1-yl)ethanimidamide |
|---|---|
| PubChem CID | 142149444 |
| Molecular Formula | C11H11FN2 |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | N'-ethenyl-2-(3-fluorocyclohepta-1,3,5,6-tetraen-1-yl)ethanimidamide |
| SMILES | C=C/N=C(\N)CC1=CC(F)=CC=C=C1 |
| InChI | InChI=1S/C11H11FN2/c1-2-14-11(13)8-9-5-3-4-6-10(12)7-9/h2,4-7H,1,8H2,(H2,13,14) |
| InChIKey | MKVQFPAWZHHEOE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|