C10H14O3 — CID 14214945
5-hydroxy-3,3a-dimethyl-4-methylidene-3,5,6,6a-tetrahydrocyclopenta[b]furan-2-one (PubChem CID 14214945) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 5-hydroxy-3,3a-dimethyl-4-methylidene-3,5,6,6a-tetrahydrocyclopenta[b]furan-2-one.
| Compound Name | 5-hydroxy-3,3a-dimethyl-4-methylidene-3,5,6,6a-tetrahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 14214945 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 5-hydroxy-3,3a-dimethyl-4-methylidene-3,5,6,6a-tetrahydrocyclopenta[b]furan-2-one |
| SMILES | C=C1C(O)CC2OC(=O)C(C)C12C |
| InChI | InChI=1S/C10H14O3/c1-5-7(11)4-8-10(5,3)6(2)9(12)13-8/h6-8,11H,1,4H2,2-3H3 |
| InChIKey | NEPXRTVSAMVHCD-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|