C21H17NO2S — CID 142149920
1-amino-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfanylanthracene-9,10-dione (PubChem CID 142149920) has the molecular formula C21H17NO2S and a molecular weight of 347.44 g/mol. Its IUPAC name is 1-amino-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfanylanthracene-9,10-dione.
| Compound Name | 1-amino-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfanylanthracene-9,10-dione |
|---|---|
| PubChem CID | 142149920 |
| Molecular Formula | C21H17NO2S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 1-amino-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfanylanthracene-9,10-dione |
| SMILES | C=C/C=C(\C=C/C)Sc1ccc(N)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H17NO2S/c1-3-7-13(8-4-2)25-17-12-11-16(22)18-19(17)21(24)15-10-6-5-9-14(15)20(18)23/h3-12H,1,22H2,2H3/b8-4-,13-7+ |
| InChIKey | MPKVXNFEDZUSEQ-UYPGYXLJSA-N |
| XLogP | 4.78 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|