C16H30N2 — CID 142150062
4-[(3,3-dimethylbutylamino)methyl]aniline;propane (PubChem CID 142150062) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is 4-[(3,3-dimethylbutylamino)methyl]aniline;propane.
| Compound Name | 4-[(3,3-dimethylbutylamino)methyl]aniline;propane |
|---|---|
| PubChem CID | 142150062 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | 4-[(3,3-dimethylbutylamino)methyl]aniline;propane |
| SMILES | CC(C)(C)CCNCc1ccc(N)cc1.CCC |
| InChI | InChI=1S/C13H22N2.C3H8/c1-13(2,3)8-9-15-10-11-4-6-12(14)7-5-11;1-3-2/h4-7,15H,8-10,14H2,1-3H3;3H2,1-2H3 |
| InChIKey | WKBOCMYYGYEBIT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|