C12H10N2O3 — CID 142150607
2-(4-imino-3-oxobutan-2-yl)isoindole-1,3-dione (PubChem CID 142150607) has the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. Its IUPAC name is 2-(4-imino-3-oxobutan-2-yl)isoindole-1,3-dione.
| Compound Name | 2-(4-imino-3-oxobutan-2-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 142150607 |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2-(4-imino-3-oxobutan-2-yl)isoindole-1,3-dione |
| SMILES | [H]/N=C/C(=O)C(C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C12H10N2O3/c1-7(10(15)6-13)14-11(16)8-4-2-3-5-9(8)12(14)17/h2-7,13H,1H3/b13-6+ |
| InChIKey | NEDICAWGBBFSGT-AWNIVKPZSA-N |
| XLogP | 0.89 |
| TPSA | 78.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|