About ethane;6,6,8-trimethylcyclohepta[b]thiophene
ethane;6,6,8-trimethylcyclohepta[b]thiophene (PubChem CID 142150730) has the molecular formula C16H26S
and a molecular weight of 250.45 g/mol. Its IUPAC name is ethane;6,6,8-trimethylcyclohepta[b]thiophene.
Molecular Properties
| Compound Name | ethane;6,6,8-trimethylcyclohepta[b]thiophene |
| PubChem CID | 142150730 |
| Molecular Formula | C16H26S |
| Molecular Weight | 250.45 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | ethane;6,6,8-trimethylcyclohepta[b]thiophene |
| SMILES | CC.CC.CC1=CC(C)(C)C=Cc2ccsc21 |
| InChI | InChI=1S/C12H14S.2C2H6/c1-9-8-12(2,3)6-4-10-5-7-13-11(9)10;2*1-2/h4-8H,1-3H3;2*1-2H3 |
| InChIKey | IWOOHLZQVWOFJJ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.45 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;6,6,8-trimethylcyclohepta[b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6,6,8-trimethylcyclohepta[b]thiophene?
The IUPAC name of ethane;6,6,8-trimethylcyclohepta[b]thiophene (CID 142150730) is ethane;6,6,8-trimethylcyclohepta[b]thiophene.
What is the SMILES notation for ethane;6,6,8-trimethylcyclohepta[b]thiophene?
The canonical SMILES for ethane;6,6,8-trimethylcyclohepta[b]thiophene is CC.CC.CC1=CC(C)(C)C=Cc2ccsc21.
What is the InChIKey of ethane;6,6,8-trimethylcyclohepta[b]thiophene?
The InChIKey is IWOOHLZQVWOFJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14S.2C2H6/c1-9-8-12(2,3)6-4-10-5-7-13-11(9)10;2*1-2/h4-8H,1-3H3;2*1-2H3.
What are the key properties of ethane;6,6,8-trimethylcyclohepta[b]thiophene?
ethane;6,6,8-trimethylcyclohepta[b]thiophene has a molecular weight of 250.45 g/mol, XLogP of 6.26, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6,6,8-trimethylcyclohepta[b]thiophene is sourced from PubChem (CID 142150730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).