C17H19NO6 — CID 142150887
4-hydroxy-11-hydroxyimino-10-propoxycarbonyltricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9-carboxylic acid (PubChem CID 142150887) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is 4-hydroxy-11-hydroxyimino-10-propoxycarbonyltricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9-carboxylic acid.
| Compound Name | 4-hydroxy-11-hydroxyimino-10-propoxycarbonyltricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9-carboxylic acid |
|---|---|
| PubChem CID | 142150887 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 4-hydroxy-11-hydroxyimino-10-propoxycarbonyltricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9-carboxylic acid |
| SMILES | CCCOC(=O)C1C2C(=NO)CC(c3ccc(O)cc32)C1C(=O)O |
| InChI | InChI=1S/C17H19NO6/c1-2-5-24-17(22)15-13-10-6-8(19)3-4-9(10)11(7-12(13)18-23)14(15)16(20)21/h3-4,6,11,13-15,19,23H,2,5,7H2,1H3,(H,20,21) |
| InChIKey | ZUNBJWDMPMCIBI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|