C21H18FNO6 — CID 142150890
11-[(4-fluorophenyl)methoxyimino]-4-hydroxytricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylic acid (PubChem CID 142150890) has the molecular formula C21H18FNO6 and a molecular weight of 399.37 g/mol. Its IUPAC name is 11-[(4-fluorophenyl)methoxyimino]-4-hydroxytricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylic acid.
| Compound Name | 11-[(4-fluorophenyl)methoxyimino]-4-hydroxytricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylic acid |
|---|---|
| PubChem CID | 142150890 |
| Molecular Formula | C21H18FNO6 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 11-[(4-fluorophenyl)methoxyimino]-4-hydroxytricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylic acid |
| SMILES | O=C(O)C1C2CC(=NOCc3ccc(F)cc3)C(c3cc(O)ccc32)C1C(=O)O |
| InChI | InChI=1S/C21H18FNO6/c22-11-3-1-10(2-4-11)9-29-23-16-8-15-13-6-5-12(24)7-14(13)17(16)19(21(27)28)18(15)20(25)26/h1-7,15,17-19,24H,8-9H2,(H,25,26)(H,27,28) |
| InChIKey | OWLBNEHZVMLLKZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|