C11H18N2O2 — CID 142151029
3-amino-N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-2-hydroxypropanamide (PubChem CID 142151029) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-amino-N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-2-hydroxypropanamide.
| Compound Name | 3-amino-N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 142151029 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 3-amino-N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-2-hydroxypropanamide |
| SMILES | C=C/C=C\C(=C/C)CNC(=O)C(O)CN |
| InChI | InChI=1S/C11H18N2O2/c1-3-5-6-9(4-2)8-13-11(15)10(14)7-12/h3-6,10,14H,1,7-8,12H2,2H3,(H,13,15)/b6-5-,9-4+ |
| InChIKey | SUIOBVKFUQZNPG-CXBDEZGUSA-N |
| XLogP | 0.11 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|