C26H26Br2N6O4S2 — CID 142151168
5-(4-bromophenyl)-6-[2-(5-bromopyrimidin-2-yl)oxyethoxy]-N-(thiophen-2-ylmethylsulfamoyl)pyrimidin-4-amine;(3Z)-penta-1,3-diene (PubChem CID 142151168) has the molecular formula C26H26Br2N6O4S2 and a molecular weight of 710.47 g/mol. Its IUPAC name is 5-(4-bromophenyl)-6-[2-(5-bromopyrimidin-2-yl)oxyethoxy]-N-(thiophen-2-ylmethylsulfamoyl)pyrimidin-4-amine;(3Z)-penta-1,3-diene.
| Compound Name | 5-(4-bromophenyl)-6-[2-(5-bromopyrimidin-2-yl)oxyethoxy]-N-(thiophen-2-ylmethylsulfamoyl)pyrimidin-4-amine;(3Z)-penta-1,3-diene |
|---|---|
| PubChem CID | 142151168 |
| Molecular Formula | C26H26Br2N6O4S2 |
| Molecular Weight | 710.47 g/mol |
| Exact Mass | 707.98 |
| IUPAC Name | 5-(4-bromophenyl)-6-[2-(5-bromopyrimidin-2-yl)oxyethoxy]-N-(thiophen-2-ylmethylsulfamoyl)pyrimidin-4-amine;(3Z)-penta-1,3-diene |
| SMILES | C=C/C=C\C.O=S(=O)(NCc1cccs1)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H18Br2N6O4S2.C5H8/c22-15-5-3-14(4-6-15)18-19(29-35(30,31)28-12-17-2-1-9-34-17)26-13-27-20(18)32-7-8-33-21-24-10-16(23)11-25-21;1-3-5-4-2/h1-6,9-11,13,28H,7-8,12H2,(H,26,27,29);3-5H,1H2,2H3/b;5-4- |
| InChIKey | FRMUVTJSWKJGQW-GUHKXDMSSA-N |
| XLogP | 6.17 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.47 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|