About 1,4-dimethyl-2-(methylsulfanylmethyl)pyrrolidine;ethane
1,4-dimethyl-2-(methylsulfanylmethyl)pyrrolidine;ethane (PubChem CID 142151788) has the molecular formula C10H23NS
and a molecular weight of 189.37 g/mol. Its IUPAC name is 1,4-dimethyl-2-(methylsulfanylmethyl)pyrrolidine;ethane.
Molecular Properties
| Compound Name | 1,4-dimethyl-2-(methylsulfanylmethyl)pyrrolidine;ethane |
| PubChem CID | 142151788 |
| Molecular Formula | C10H23NS |
| Molecular Weight | 189.37 g/mol |
| Exact Mass | 189.16 |
| IUPAC Name | 1,4-dimethyl-2-(methylsulfanylmethyl)pyrrolidine;ethane |
| SMILES | CC.CSCC1CC(C)CN1C |
| InChI | InChI=1S/C8H17NS.C2H6/c1-7-4-8(6-10-3)9(2)5-7;1-2/h7-8H,4-6H2,1-3H3;1-2H3 |
| InChIKey | JEKZFPBWQITOIN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-dimethyl-2-(methylsulfanylmethyl)pyrrolidine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethyl-2-(methylsulfanylmethyl)pyrrolidine;ethane?
The IUPAC name of 1,4-dimethyl-2-(methylsulfanylmethyl)pyrrolidine;ethane (CID 142151788) is 1,4-dimethyl-2-(methylsulfanylmethyl)pyrrolidine;ethane.
What is the SMILES notation for 1,4-dimethyl-2-(methylsulfanylmethyl)pyrrolidine;ethane?
The canonical SMILES for 1,4-dimethyl-2-(methylsulfanylmethyl)pyrrolidine;ethane is CC.CSCC1CC(C)CN1C.
What is the InChIKey of 1,4-dimethyl-2-(methylsulfanylmethyl)pyrrolidine;ethane?
The InChIKey is JEKZFPBWQITOIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NS.C2H6/c1-7-4-8(6-10-3)9(2)5-7;1-2/h7-8H,4-6H2,1-3H3;1-2H3.
What are the key properties of 1,4-dimethyl-2-(methylsulfanylmethyl)pyrrolidine;ethane?
1,4-dimethyl-2-(methylsulfanylmethyl)pyrrolidine;ethane has a molecular weight of 189.37 g/mol, XLogP of 2.72, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyl-2-(methylsulfanylmethyl)pyrrolidine;ethane is sourced from PubChem (CID 142151788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).