About ethane;2-[1-[ethyl(methyl)amino]butan-2-yloxy]acetic acid
ethane;2-[1-[ethyl(methyl)amino]butan-2-yloxy]acetic acid (PubChem CID 142151828) has the molecular formula C11H25NO3
and a molecular weight of 219.32 g/mol. Its IUPAC name is ethane;2-[1-[ethyl(methyl)amino]butan-2-yloxy]acetic acid.
Molecular Properties
| Compound Name | ethane;2-[1-[ethyl(methyl)amino]butan-2-yloxy]acetic acid |
| PubChem CID | 142151828 |
| Molecular Formula | C11H25NO3 |
| Molecular Weight | 219.32 g/mol |
| Exact Mass | 219.18 |
| IUPAC Name | ethane;2-[1-[ethyl(methyl)amino]butan-2-yloxy]acetic acid |
| SMILES | CC.CCC(CN(C)CC)OCC(=O)O |
| InChI | InChI=1S/C9H19NO3.C2H6/c1-4-8(6-10(3)5-2)13-7-9(11)12;1-2/h8H,4-7H2,1-3H3,(H,11,12);1-2H3 |
| InChIKey | XXDIKKPLHQMDRF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-[1-[ethyl(methyl)amino]butan-2-yloxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-[1-[ethyl(methyl)amino]butan-2-yloxy]acetic acid?
The IUPAC name of ethane;2-[1-[ethyl(methyl)amino]butan-2-yloxy]acetic acid (CID 142151828) is ethane;2-[1-[ethyl(methyl)amino]butan-2-yloxy]acetic acid.
What is the SMILES notation for ethane;2-[1-[ethyl(methyl)amino]butan-2-yloxy]acetic acid?
The canonical SMILES for ethane;2-[1-[ethyl(methyl)amino]butan-2-yloxy]acetic acid is CC.CCC(CN(C)CC)OCC(=O)O.
What is the InChIKey of ethane;2-[1-[ethyl(methyl)amino]butan-2-yloxy]acetic acid?
The InChIKey is XXDIKKPLHQMDRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO3.C2H6/c1-4-8(6-10(3)5-2)13-7-9(11)12;1-2/h8H,4-7H2,1-3H3,(H,11,12);1-2H3.
What are the key properties of ethane;2-[1-[ethyl(methyl)amino]butan-2-yloxy]acetic acid?
ethane;2-[1-[ethyl(methyl)amino]butan-2-yloxy]acetic acid has a molecular weight of 219.32 g/mol, XLogP of 1.84, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-[1-[ethyl(methyl)amino]butan-2-yloxy]acetic acid is sourced from PubChem (CID 142151828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).