About 3-fluoro-1,5-dimethyl-2-(methylsulfanylmethyl)pyrrolidine
3-fluoro-1,5-dimethyl-2-(methylsulfanylmethyl)pyrrolidine (PubChem CID 142151835) has the molecular formula C8H16FNS
and a molecular weight of 177.29 g/mol. Its IUPAC name is 3-fluoro-1,5-dimethyl-2-(methylsulfanylmethyl)pyrrolidine.
Molecular Properties
| Compound Name | 3-fluoro-1,5-dimethyl-2-(methylsulfanylmethyl)pyrrolidine |
| PubChem CID | 142151835 |
| Molecular Formula | C8H16FNS |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 3-fluoro-1,5-dimethyl-2-(methylsulfanylmethyl)pyrrolidine |
| SMILES | CSCC1C(F)CC(C)N1C |
| InChI | InChI=1S/C8H16FNS/c1-6-4-7(9)8(5-11-3)10(6)2/h6-8H,4-5H2,1-3H3 |
| InChIKey | CDBRWFYOCJIKII-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-fluoro-1,5-dimethyl-2-(methylsulfanylmethyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-1,5-dimethyl-2-(methylsulfanylmethyl)pyrrolidine?
The IUPAC name of 3-fluoro-1,5-dimethyl-2-(methylsulfanylmethyl)pyrrolidine (CID 142151835) is 3-fluoro-1,5-dimethyl-2-(methylsulfanylmethyl)pyrrolidine.
What is the SMILES notation for 3-fluoro-1,5-dimethyl-2-(methylsulfanylmethyl)pyrrolidine?
The canonical SMILES for 3-fluoro-1,5-dimethyl-2-(methylsulfanylmethyl)pyrrolidine is CSCC1C(F)CC(C)N1C.
What is the InChIKey of 3-fluoro-1,5-dimethyl-2-(methylsulfanylmethyl)pyrrolidine?
The InChIKey is CDBRWFYOCJIKII-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16FNS/c1-6-4-7(9)8(5-11-3)10(6)2/h6-8H,4-5H2,1-3H3.
What are the key properties of 3-fluoro-1,5-dimethyl-2-(methylsulfanylmethyl)pyrrolidine?
3-fluoro-1,5-dimethyl-2-(methylsulfanylmethyl)pyrrolidine has a molecular weight of 177.29 g/mol, XLogP of 1.78, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-1,5-dimethyl-2-(methylsulfanylmethyl)pyrrolidine is sourced from PubChem (CID 142151835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).