C17H28F2N2O4 — CID 142152132
(4aR,6S,8aR)-6-[[1-carboxyethyl(2,2-difluoropropyl)amino]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid (PubChem CID 142152132) has the molecular formula C17H28F2N2O4 and a molecular weight of 362.42 g/mol. Its IUPAC name is (4aR,6S,8aR)-6-[[1-carboxyethyl(2,2-difluoropropyl)amino]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid.
| Compound Name | (4aR,6S,8aR)-6-[[1-carboxyethyl(2,2-difluoropropyl)amino]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 142152132 |
| Molecular Formula | C17H28F2N2O4 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | (4aR,6S,8aR)-6-[[1-carboxyethyl(2,2-difluoropropyl)amino]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid |
| SMILES | CC(C(=O)O)N(C[C@H]1CC[C@H]2CNC(C(=O)O)C[C@H]2C1)CC(C)(F)F |
| InChI | InChI=1S/C17H28F2N2O4/c1-10(15(22)23)21(9-17(2,18)19)8-11-3-4-12-7-20-14(16(24)25)6-13(12)5-11/h10-14,20H,3-9H2,1-2H3,(H,22,23)(H,24,25)/t10?,11-,12-,13+,14?/m0/s1 |
| InChIKey | OCEURYZBZDSRRG-VWGAPNJBSA-N |
| XLogP | 1.90 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |